Other Solvents
Filtered Search Results
p-Xylene, 99%, for spectroscopy
CAS: 106-42-3 Molecular Formula: C8H10 Molecular Weight (g/mol): 106.17 MDL Number: MFCD00008556 InChI Key: URLKBWYHVLBVBO-UHFFFAOYSA-N Synonym: 1, 4-Dimethylbenzene PubChem CID: 7809 ChEBI: CHEBI:27417 IUPAC Name: 1,4-xylene SMILES: CC1=CC=C(C)C=C1
| PubChem CID | 7809 |
|---|---|
| CAS | 106-42-3 |
| Molecular Weight (g/mol) | 106.17 |
| ChEBI | CHEBI:27417 |
| MDL Number | MFCD00008556 |
| SMILES | CC1=CC=C(C)C=C1 |
| Synonym | 1, 4-Dimethylbenzene |
| IUPAC Name | 1,4-xylene |
| InChI Key | URLKBWYHVLBVBO-UHFFFAOYSA-N |
| Molecular Formula | C8H10 |
| Chemical Name or Material | Beta Max-ES liquid scintillation cocktail |
|---|
| Water | 50ppm max. |
|---|---|
| Linear Formula | CH3OCH2CH2OCH3 |
| Chemical Name or Material | Ethylene glycol dimethyl ether |
| Grade | Extra Dry |
| Identification | Pass Test |
| Merck Index | 15, 3245 |
| Density | 0.8670g/mL |
| Vapor Pressure | Vapor Pressure: 64hPa at 20°C |
| Assay Percent Range | 99% |
| Percent Purity | ≥99% |
| Fieser | 01,267; 02,143; 16,229 |
| CAS | 128-37-0 |
| Health Hazard 3 | GHS P Statement: Obtain special instructions before use. IF exposed or concerned: Get medical advice/attention. Keep container tightly closed. IF INHALED: Remove victim to fresh air and keep at rest in a position comfortable for breathing. Keep away from heat/sparks/open flames/hot surfaces. - No smoking. WARNING: The information provided on this web site was developed in compliance with European Union (EU) regulations and is correct to the best of our knowledge, information and belief at the date of its publication. The information given is designed only as a guide for safe handling and use. It is not to be considered as either a warranty or quality specification. |
| Health Hazard 2 | GHS H Statement: Harmful if inhaled. May damage fertility. May damage the unborn child. Highly flammable liquid and vapor. May form explosive peroxides. |
| Packaging | AcroSeal™ Glass Bottle |
| Health Hazard 1 | Danger |
| Synonym | monoglyme,ethylene glycol dimethyl ether,glyme,dimethyl cellosolve,egdme,ethane, 1,2-dimethoxy,dimethoxyethane,2,5-dioxahexane,glycol dimethyl ether,ethylene dimethyl ether |
| TSCA | TSCA |
| RTECS Number | KI1451000 |
| Beilstein | 01, 467 |
| EINECS Number | 203-794-9 |
| Formula Weight | 90.12 |
3,5-Dimethylanisole, 99%
CAS: 874-63-5 Molecular Formula: C9H12O Molecular Weight (g/mol): 136.194 MDL Number: MFCD00008398 InChI Key: JCHJBEZBHANKGA-UHFFFAOYSA-N Synonym: 3,5-dimethylanisole,5-methoxy-m-xylene,benzene, 1-methoxy-3,5-dimethyl,1-methoxy-3,5-dimethyl-benzene,3,5-dimethylanisol,3,5-dimethylanizole,acmc-1bkxt,anisole, 3,5-dimethyl,ksc494e7h,5-methoxy-1,3-dimethylbenzene PubChem CID: 70126 IUPAC Name: 1-methoxy-3,5-dimethylbenzene SMILES: CC1=CC(=CC(=C1)OC)C
| PubChem CID | 70126 |
|---|---|
| CAS | 874-63-5 |
| Molecular Weight (g/mol) | 136.194 |
| MDL Number | MFCD00008398 |
| SMILES | CC1=CC(=CC(=C1)OC)C |
| Synonym | 3,5-dimethylanisole,5-methoxy-m-xylene,benzene, 1-methoxy-3,5-dimethyl,1-methoxy-3,5-dimethyl-benzene,3,5-dimethylanisol,3,5-dimethylanizole,acmc-1bkxt,anisole, 3,5-dimethyl,ksc494e7h,5-methoxy-1,3-dimethylbenzene |
| IUPAC Name | 1-methoxy-3,5-dimethylbenzene |
| InChI Key | JCHJBEZBHANKGA-UHFFFAOYSA-N |
| Molecular Formula | C9H12O |
Xylenes, 98.5%, MilliporeSigma™
CAS: 1330-20-7 Molecular Weight (g/mol): 106.17
| CAS | 1330-20-7 |
|---|---|
| Molecular Weight (g/mol) | 106.17 |
2,5-Dimethylbenzenesulfonyl chloride, 98%, Thermo Scientific™
CAS: 19040-62-1 Molecular Formula: C8H9ClO2S Molecular Weight (g/mol): 204.668 MDL Number: MFCD00024875 InChI Key: FZVZUIBYLZZOEW-UHFFFAOYSA-N Synonym: p-xylene-2-sulfonyl chloride,benzenesulfonyl chloride, 2,5-dimethyl,2,5-dimethylbenzene-1-sulfonyl chloride,2,5-dimethylphenylsulfonyl chloride,2,5-dimethyl-benzenesulfonyl chloride,benzenesulfonylchloride, 2,5-dimethyl,2,5-dimethylphenyl chlorosulfone,acmc-209etq,xylenesulfonylchloride,ksc178m0f PubChem CID: 87910 IUPAC Name: 2,5-dimethylbenzenesulfonyl chloride SMILES: CC1=CC(=C(C=C1)C)S(=O)(=O)Cl
| PubChem CID | 87910 |
|---|---|
| CAS | 19040-62-1 |
| Molecular Weight (g/mol) | 204.668 |
| MDL Number | MFCD00024875 |
| SMILES | CC1=CC(=C(C=C1)C)S(=O)(=O)Cl |
| Synonym | p-xylene-2-sulfonyl chloride,benzenesulfonyl chloride, 2,5-dimethyl,2,5-dimethylbenzene-1-sulfonyl chloride,2,5-dimethylphenylsulfonyl chloride,2,5-dimethyl-benzenesulfonyl chloride,benzenesulfonylchloride, 2,5-dimethyl,2,5-dimethylphenyl chlorosulfone,acmc-209etq,xylenesulfonylchloride,ksc178m0f |
| IUPAC Name | 2,5-dimethylbenzenesulfonyl chloride |
| InChI Key | FZVZUIBYLZZOEW-UHFFFAOYSA-N |
| Molecular Formula | C8H9ClO2S |
2,4-Dimethylbenzoic acid, 97%
CAS: 611-01-8 Molecular Formula: C9H10O2 Molecular Weight (g/mol): 150.18 MDL Number: MFCD00002480 InChI Key: BKYWPNROPGQIFZ-UHFFFAOYSA-N Synonym: benzoic acid, 2,4-dimethyl,4-carboxy-1,3-dimethylbenzene,2,4-dimethyl benzoic acid,m-xylene-4-carboxylic acid,2,4-dimethyl-benzoic acid,2,4-dimethylbenzoicacid,m-xylylic acid,pubchem15441,2,4 dimethylbenzoic acid,benzoic acid,4-dimethyl PubChem CID: 11897 ChEBI: CHEBI:64811 IUPAC Name: 2,4-dimethylbenzoic acid SMILES: CC1=CC=C(C(O)=O)C(C)=C1
| PubChem CID | 11897 |
|---|---|
| CAS | 611-01-8 |
| Molecular Weight (g/mol) | 150.18 |
| ChEBI | CHEBI:64811 |
| MDL Number | MFCD00002480 |
| SMILES | CC1=CC=C(C(O)=O)C(C)=C1 |
| Synonym | benzoic acid, 2,4-dimethyl,4-carboxy-1,3-dimethylbenzene,2,4-dimethyl benzoic acid,m-xylene-4-carboxylic acid,2,4-dimethyl-benzoic acid,2,4-dimethylbenzoicacid,m-xylylic acid,pubchem15441,2,4 dimethylbenzoic acid,benzoic acid,4-dimethyl |
| IUPAC Name | 2,4-dimethylbenzoic acid |
| InChI Key | BKYWPNROPGQIFZ-UHFFFAOYSA-N |
| Molecular Formula | C9H10O2 |
4-Chloro-m-xylene, 97%
CAS: 95-66-9 Molecular Formula: C8H9Cl Molecular Weight (g/mol): 140.61 MDL Number: MFCD00060644 InChI Key: UIEVCEQLNUHDIF-UHFFFAOYSA-N Synonym: 4-chloro-m-xylene,m-xylene, 4-chloro,2,4-dimethylchlorobenzene,benzene, 1-chloro-2,4-dimethyl,mxylene4chloro,1-chloro-2,4-dimethyl-benzene,4-chlor-m-xylol,pubchem3639,acmc-209rzq,4-chloro-meta-xylene PubChem CID: 523153 IUPAC Name: 1-chloro-2,4-dimethylbenzene SMILES: CC1=CC(=C(C=C1)Cl)C
| PubChem CID | 523153 |
|---|---|
| CAS | 95-66-9 |
| Molecular Weight (g/mol) | 140.61 |
| MDL Number | MFCD00060644 |
| SMILES | CC1=CC(=C(C=C1)Cl)C |
| Synonym | 4-chloro-m-xylene,m-xylene, 4-chloro,2,4-dimethylchlorobenzene,benzene, 1-chloro-2,4-dimethyl,mxylene4chloro,1-chloro-2,4-dimethyl-benzene,4-chlor-m-xylol,pubchem3639,acmc-209rzq,4-chloro-meta-xylene |
| IUPAC Name | 1-chloro-2,4-dimethylbenzene |
| InChI Key | UIEVCEQLNUHDIF-UHFFFAOYSA-N |
| Molecular Formula | C8H9Cl |
2-Fluoro-1,3-dimethylbenzene, 97%, Thermo Scientific™
CAS: 443-88-9 Molecular Formula: C8H9F Molecular Weight (g/mol): 124.158 MDL Number: MFCD00039215 InChI Key: JTAUTNBVFDTYTI-UHFFFAOYSA-N Synonym: 2,6-dimethylfluorobenzene,2-fluoro-m-xylene,1-fluoro-2,6-dimethylbenzene,1,3-dimethyl-2-fluorobenzene,benzene, 2-fluoro-1,3-dimethyl,2,6-dimethyl fluorobenzene,2-fluoro-1,3-dimethyl-benzene,fr b1 f1,pubchem4407,2-fluoro-3-methyltoluene PubChem CID: 123065 IUPAC Name: 2-fluoro-1,3-dimethylbenzene SMILES: CC1=C(C(=CC=C1)C)F
| PubChem CID | 123065 |
|---|---|
| CAS | 443-88-9 |
| Molecular Weight (g/mol) | 124.158 |
| MDL Number | MFCD00039215 |
| SMILES | CC1=C(C(=CC=C1)C)F |
| Synonym | 2,6-dimethylfluorobenzene,2-fluoro-m-xylene,1-fluoro-2,6-dimethylbenzene,1,3-dimethyl-2-fluorobenzene,benzene, 2-fluoro-1,3-dimethyl,2,6-dimethyl fluorobenzene,2-fluoro-1,3-dimethyl-benzene,fr b1 f1,pubchem4407,2-fluoro-3-methyltoluene |
| IUPAC Name | 2-fluoro-1,3-dimethylbenzene |
| InChI Key | JTAUTNBVFDTYTI-UHFFFAOYSA-N |
| Molecular Formula | C8H9F |
1,4-Diiodo-2,5-dimethylbenzene, 97%, Thermo Scientific™
CAS: 1124-08-9 Molecular Formula: C8H8I2 Molecular Weight (g/mol): 357.96 MDL Number: MFCD00829126 InChI Key: WJYYUEQVECTILJ-UHFFFAOYSA-N Synonym: 2,5-diiodo-p-xylene,benzene,1,4-diiodo-2,5-dimethyl,2,5-diiodo-rho-xylene,maybridge1_002567,1,4-bis iodanyl-2,5-dimethyl-benzene PubChem CID: 2736171 IUPAC Name: 1,4-diiodo-2,5-dimethylbenzene SMILES: CC1=CC(I)=C(C)C=C1I
| PubChem CID | 2736171 |
|---|---|
| CAS | 1124-08-9 |
| Molecular Weight (g/mol) | 357.96 |
| MDL Number | MFCD00829126 |
| SMILES | CC1=CC(I)=C(C)C=C1I |
| Synonym | 2,5-diiodo-p-xylene,benzene,1,4-diiodo-2,5-dimethyl,2,5-diiodo-rho-xylene,maybridge1_002567,1,4-bis iodanyl-2,5-dimethyl-benzene |
| IUPAC Name | 1,4-diiodo-2,5-dimethylbenzene |
| InChI Key | WJYYUEQVECTILJ-UHFFFAOYSA-N |
| Molecular Formula | C8H8I2 |
1-(2,4-Dimethylphenyl)ethanol, 95%
CAS: 5379-19-1 Molecular Formula: C10H14O Molecular Weight (g/mol): 150.221 MDL Number: MFCD00060890 InChI Key: DNHQUGRUHBFDFT-UHFFFAOYSA-N Synonym: 1-2,4-dimethylphenyl ethanol,1-2,4-dimethylphenyl ethan-1-ol,1-2,4-dimethylbenzene-1-ethanol PubChem CID: 21475 IUPAC Name: 1-(2,4-dimethylphenyl)ethanol SMILES: CC1=CC(=C(C=C1)C(C)O)C
| PubChem CID | 21475 |
|---|---|
| CAS | 5379-19-1 |
| Molecular Weight (g/mol) | 150.221 |
| MDL Number | MFCD00060890 |
| SMILES | CC1=CC(=C(C=C1)C(C)O)C |
| Synonym | 1-2,4-dimethylphenyl ethanol,1-2,4-dimethylphenyl ethan-1-ol,1-2,4-dimethylbenzene-1-ethanol |
| IUPAC Name | 1-(2,4-dimethylphenyl)ethanol |
| InChI Key | DNHQUGRUHBFDFT-UHFFFAOYSA-N |
| Molecular Formula | C10H14O |
| CAS | 1330-20-7 |
|---|---|
| MDL Number | MFCD00077264 |
2,6-Dimethylbenzoic acid, 99%
CAS: 632-46-2 Molecular Formula: C9H10O2 Molecular Weight (g/mol): 150.18 MDL Number: MFCD00002483 InChI Key: HCBHQDKBSKYGCK-UHFFFAOYSA-N Synonym: benzoic acid, 2,6-dimethyl,2,6-dimethylbenzoicacid,2,6-dimethyl-benzoic acid,vic-m-xylylic acid,2,6-dimethyl benzoic acid,m-xylene-2-carboxylic acid,2,6-dimethylbenzene carboxylic acid,benzoic acid, 2,6-dimethyl-7ci,8ci,9ci,zlchem 286,vic.-m-xylylic acid PubChem CID: 12439 ChEBI: CHEBI:64827 IUPAC Name: 2,6-dimethylbenzoic acid SMILES: CC1=C(C(=CC=C1)C)C(=O)O
| PubChem CID | 12439 |
|---|---|
| CAS | 632-46-2 |
| Molecular Weight (g/mol) | 150.18 |
| ChEBI | CHEBI:64827 |
| MDL Number | MFCD00002483 |
| SMILES | CC1=C(C(=CC=C1)C)C(=O)O |
| Synonym | benzoic acid, 2,6-dimethyl,2,6-dimethylbenzoicacid,2,6-dimethyl-benzoic acid,vic-m-xylylic acid,2,6-dimethyl benzoic acid,m-xylene-2-carboxylic acid,2,6-dimethylbenzene carboxylic acid,benzoic acid, 2,6-dimethyl-7ci,8ci,9ci,zlchem 286,vic.-m-xylylic acid |
| IUPAC Name | 2,6-dimethylbenzoic acid |
| InChI Key | HCBHQDKBSKYGCK-UHFFFAOYSA-N |
| Molecular Formula | C9H10O2 |
2-Chloro-N-(2,3-dimethylphenyl)benzamide, 97%
CAS: 196617-88-6 Molecular Formula: C15H14ClNO Molecular Weight (g/mol): 259.733 MDL Number: MFCD00018254 InChI Key: OUAGJVUPQKYHDU-UHFFFAOYSA-N Synonym: 2-chloro-n-2,3-dimethylphenyl benzamide,cambridge id 5328590,2-chloro-2',3'-benzoxylidide,2-chloro-n-2,3-dimethyl-phenyl-benzamide,n-2,3-dimethylphenyl 2-chlorophenyl carboxamide PubChem CID: 295079 IUPAC Name: 2-chloro-N-(2,3-dimethylphenyl)benzamide SMILES: CC1=C(C(=CC=C1)NC(=O)C2=CC=CC=C2Cl)C
| PubChem CID | 295079 |
|---|---|
| CAS | 196617-88-6 |
| Molecular Weight (g/mol) | 259.733 |
| MDL Number | MFCD00018254 |
| SMILES | CC1=C(C(=CC=C1)NC(=O)C2=CC=CC=C2Cl)C |
| Synonym | 2-chloro-n-2,3-dimethylphenyl benzamide,cambridge id 5328590,2-chloro-2',3'-benzoxylidide,2-chloro-n-2,3-dimethyl-phenyl-benzamide,n-2,3-dimethylphenyl 2-chlorophenyl carboxamide |
| IUPAC Name | 2-chloro-N-(2,3-dimethylphenyl)benzamide |
| InChI Key | OUAGJVUPQKYHDU-UHFFFAOYSA-N |
| Molecular Formula | C15H14ClNO |
Xylenes, 98+%, Extra Dry, mixed isomers, AcroSeal™
CAS: 1330-20-7 Molecular Formula: C8H10 MDL Number: MFCD00077264
| CAS | 1330-20-7 |
|---|---|
| MDL Number | MFCD00077264 |
| Molecular Formula | C8H10 |